β-Aminoamphetamine
1-Phenylpropane-1,2-diamine
 2461 C9H14N2 150.221
 InChI=1S/C9H14N2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9H,10-11H2,1H3
 PRCXGQJVEKZKQR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(c1ccccc1)C(N)C