N,N-Dimethyl-2-aminotetralin
N,N-Dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1322 C12H17N 175.27
 InChI=1S/C12H17N/c1-13(2)12-8-7-10-5-3-4-6-11(10)9-12/h3-6,12H,7-9H2,1-2H3
 WGCDXGZYCIMFTN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CCc2c(C1)cccc2)C