N-Isopropyl-2-aminotetralin
N-(Propan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-amine
 1320 C13H19N 189.297
 InChI=1S/C13H19N/c1-10(2)14-13-8-7-11-5-3-4-6-12(11)9-13/h3-6,10,13-14H,7-9H2,1-2H3
 NVVRCZVFMOXSDF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC1CCc2c(C1)cccc2)C