N-Propyl-2-aminotetralin
N-Propyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1319 C13H19N 189.297
 InChI=1S/C13H19N/c1-2-9-14-13-8-7-11-5-3-4-6-12(11)10-13/h3-6,13-14H,2,7-10H2,1H3
 CHNZNFYUKYAHER-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC1CCc2c(C1)cccc2