N-Ethyl-2-aminotetralin
N-Ethyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1318 C12H17N 175.27
 InChI=1S/C12H17N/c1-2-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-6,12-13H,2,7-9H2,1H3
 RDDGNJSHYAVRDT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC1CCc2c(C1)cccc2