3,4-Dimethyl-5-phenyloxazolidine
3,4-Dimethyl-5-phenyl-1,3-oxazolidine
 12260 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-9-11(13-8-12(9)2)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3
 POZQVPIDBKNJTK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1N(C)COC1c1ccccc1