1-[3-(3-Phenylpropyl)phenyl]propan-2-amine
 12201 C18H23N 253.382
 InChI=1S/C18H23N/c1-15(19)13-18-12-6-11-17(14-18)10-5-9-16-7-3-2-4-8-16/h2-4,6-8,11-12,14-15H,5,9-10,13,19H2,1H3
 AKCUSOCRABFTBZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)CCCc1ccccc1)N