4-(Furan-2-yl)butan-2-amine
 12103 C8H13NO 139.195
 InChI=1S/C8H13NO/c1-7(9)4-5-8-3-2-6-10-8/h2-3,6-7H,4-5,9H2,1H3
 FMXPHTQMUMXJKJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CCc1ccco1)N