1-(Furan-2-yl)ethan-1-amine
 12102 C6H9NO 111.142
 InChI=1S/C6H9NO/c1-5(7)6-3-2-4-8-6/h2-5H,7H2,1H3
 JYXGCMLOKDKUAX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(c1ccco1)N