N,N-Dimethyl-4,4-diphenylbutan-1-amine
 12089 C18H23N 253.382
 InChI=1S/C18H23N/c1-19(2)15-9-14-18(16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-8,10-13,18H,9,14-15H2,1-2H3
 BDSUMBDGCUOHGR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCCC(c1ccccc1)c1ccccc1)C