N-Methyl-4,4-diphenylbutan-1-amine
 12088 C17H21N 239.355
 InChI=1S/C17H21N/c1-18-14-8-13-17(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17-18H,8,13-14H2,1H3
 GRKYNTKPAFRLLZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCCC(c1ccccc1)c1ccccc1