4,4-Diphenylbutan-1-amine
 12087 C16H19N 225.329
 InChI=1S/C16H19N/c17-13-7-12-16(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13,17H2
 MAAQGZFMFXQVOG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCCC(c1ccccc1)c1ccccc1