AAZ-A-154
1-(5-Methoxy-1H-indol-1-yl)-N,N-dimethylpropan-2-amine
 11958  C14H20N2O  232.321
 InChI=1S/C14H20N2O/c1-11(15(2)3)10-16-8-7-12-9-13(17-4)5-6-14(12)16/h5-9,11H,10H2,1-4H3
 KHEUWLQKCXGVEL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)ccn2CC(N(C)C)C