2-PYMAP
N-Methyl-1-(pyridin-2-yl)propan-2-amine
 11003 C9H14N2 150.221
 InChI=1S/C9H14N2/c1-8(10-2)7-9-5-3-4-6-11-9/h3-6,8,10H,7H2,1-2H3
 LRCYOGDMXYPZAE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccccn1)C