2-(Furan-3-yl)prop-2-en-1-amine
 10944 C7H9NO 123.152
 InChI=1S/C7H9NO/c1-6(4-8)7-2-3-9-5-7/h2-3,5H,1,4,8H2
 OBBIFUJGKFYOGT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(=C)c1cocc1