2-FMAP
1-(Furan-2-yl)-N-methylpropan-2-amine
 10940 C8H13NO 139.195
 InChI=1S/C8H13NO/c1-7(9-2)6-8-4-3-5-10-8/h3-5,7,9H,6H2,1-2H3
 BFXUFGFUXGOVRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccco1)C