2-FAB
1-(Furan-2-yl)butan-2-amine
 10937 C8H13NO 139.195
 InChI=1S/C8H13NO/c1-2-7(9)6-8-4-3-5-10-8/h3-5,7H,2,6,9H2,1H3
 VFFKRTWZKJSROE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccco1)N