1-(Furan-2-yl)-2-(methylamino)propan-1-ol
 10936 C8H13NO2 155.194
 InChI=1S/C8H13NO2/c1-6(9-2)8(10)7-4-3-5-11-7/h3-6,8-10H,1-2H3
 AZXKJDSTUURASL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccco1)O)C