3-PYAP
1-(pyrIdin-3-yl)propan-2-amine
 10915 C8H12N2 136.194
 InChI=1S/C8H12N2/c1-7(9)5-8-3-2-4-10-6-8/h2-4,6-7H,5,9H2,1H3
 PUEWSNLDTZQXLN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccnc1)N