2-PYAP
1-(pyrIdin-2-yl)propan-2-amine
 10913 C8H12N2 136.194
 InChI=1S/C8H12N2/c1-7(9)6-8-4-2-3-5-10-8/h2-5,7H,6,9H2,1H3
 OKWKKGILOAMUGL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccn1)N