2-FAP
1-(Furan-2-yl)propan-2-amine
 10908 C7H11NO 125.168
 InChI=1S/C7H11NO/c1-6(8)5-7-3-2-4-9-7/h2-4,6H,5,8H2,1H3
 IDUAQSPIDXGMKI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccco1)N