N,N-Dimethyl-3,3-diphenylpropan-1-amine
 10892 C17H21N 239.355
 InChI=1S/C17H21N/c1-18(2)14-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3
 YHDCGYWZEFIUHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCC(c1ccccc1)c1ccccc1)C