N-Methyl-3,3-diphenylpropan-1-amine
 10891 C16H19N 225.329
 InChI=1S/C16H19N/c1-17-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3
 AKEGHAUFMKCWGX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCC(c1ccccc1)c1ccccc1