N,N-Dimethyl-2,2-diphenylethan-1-amine
 10889 C16H19N 225.329
 InChI=1S/C16H19N/c1-17(2)13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3
 UAUJDKBNVRSJBD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CC(c1ccccc1)c1ccccc1)C