N-Methyl-2,2-diphenylethan-1-amine
 10888 C15H17N 211.302
 InChI=1S/C15H17N/c1-16-12-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-16H,12H2,1H3
 WXSURELOKDGQNF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccccc1)c1ccccc1