2-(2-Benzylphenyl)ethan-1-amine
 10881 C15H17N 211.302
 InChI=1S/C15H17N/c16-11-10-14-8-4-5-9-15(14)12-13-6-2-1-3-7-13/h1-9H,10-12,16H2
 QWSUTGZKTVZPRT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccccc1Cc1ccccc1