1-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)methanamine
 10872 C9H11N 133.19
 InChI=1S/C9H11N/c10-6-8-5-7-3-1-2-4-9(7)8/h1-4,8H,5-6,10H2
 UOQNRKZMXTYCNA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1Cc2c1cccc2