2-Benzylmorpholine
3-Benzylmorpholine
 10869 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-2-4-10(5-3-1)8-11-9-13-7-6-12-11/h1-5,11-12H,6-9H2
 LSXCLMMIDIVSFG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O1CCNC(C1)Cc1ccccc1