2-Methyl-3-phenylpiperidine
 10868 C12H17N 175.27
 InChI=1S/C12H17N/c1-10-12(8-5-9-13-10)11-6-3-2-4-7-11/h2-4,6-7,10,12-13H,5,8-9H2,1H3
 KSUHZKBRVSSLDY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1NCCCC1c1ccccc1