2-Benzylpiperidine
 10859 C12H17N 175.27
 InChI=1S/C12H17N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-3,6-7,12-13H,4-5,8-10H2
 ITXCORRITGNIHP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCC(NC1)Cc1ccccc1