N-Benzylpiperidine
1-Benzylpiperidine
 10858 C12H17N 175.27
 InChI=1S/C12H17N/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1,3-4,7-8H,2,5-6,9-11H2
 NZVZVGPYTICZBZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCN(CC1)Cc1ccccc1