2-Methyl-3-phenylaziridine
 10839 C9H11N 133.19
 InChI=1S/C9H11N/c1-7-9(10-7)8-5-3-2-4-6-8/h2-7,9-10H,1H3
 NWAQGFVFBBSDAV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1NC1c1ccccc1