2-Phenylcyclohexan-1-amine
 10834 C12H17N 175.27
 InChI=1S/C12H17N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9,13H2
 KLJIPLWGNJQJRM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CCCCC1c1ccccc1