1,1-Diphenylpropan-2-amine
 10796 C15H17N 211.302
 InChI=1S/C15H17N/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15H,16H2,1H3
 XNKICCFGYSXSAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccccc1)c1ccccc1)N