2-Phenylprop-2-en-1-amine
 10788  C9H11N  133.19
 InChI=1S/C9H11N/c1-8(7-10)9-5-3-2-4-6-9/h2-6H,1,7,10H2
 OWCNPQKNIWRGLI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(=C)c1ccccc1