N,N-Diethyl-2-phenylbutan-1-amine
 10786 C14H23N 205.339
 InChI=1S/C14H23N/c1-4-13(12-15(5-2)6-3)14-10-8-7-9-11-14/h7-11,13H,4-6,12H2,1-3H3
 KQGCWYDMZCARBU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccccc1)CN(CC)CC