1-Phenyl-N-propylhexan-2-amine
 10776 C15H25N 219.366
 InChI=1S/C15H25N/c1-3-5-11-15(16-12-4-2)13-14-9-7-6-8-10-14/h6-10,15-16H,3-5,11-13H2,1-2H3
 JDWIAKLHBJDFAP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(Cc1ccccc1)NCCC