N-(1,2-Diphenylethyl)propan-1-amine
 10770 C17H21N 239.355
 InChI=1S/C17H21N/c1-2-13-18-17(16-11-7-4-8-12-16)14-15-9-5-3-6-10-15/h3-12,17-18H,2,13-14H2,1H3
 QDJKYFSVYJISOP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC(c1ccccc1)Cc1ccccc1