1-Phenyl-N-(propan-2-yl)pentan-2-amine
 10768 C14H23N 205.339
 InChI=1S/C14H23N/c1-4-8-14(15-12(2)3)11-13-9-6-5-7-10-13/h5-7,9-10,12,14-15H,4,8,11H2,1-3H3
 TXKXBOCIAPTSJN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(Cc1ccccc1)NC(C)C