1-Cyclobutyl-3-phenylpropan-2-amine
 10767  C13H19N  189.297
 InChI=1S/C13H19N/c14-13(10-12-7-4-8-12)9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,14H2
 YDUQPFHSPWCIDO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(Cc1ccccc1)CC1CCC1