1-Cyclopropyl-3-phenylpropan-2-amine
 10766 C12H17N 175.27
 InChI=1S/C12H17N/c13-12(9-11-6-7-11)8-10-4-2-1-3-5-10/h1-5,11-12H,6-9,13H2
 NPNHSZAVYORNSG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC(Cc1ccccc1)CC1CC1