(2-Phenylpropyl)hydrazine
 10723 C9H14N2 150.221
 InChI=1S/C9H14N2/c1-8(7-11-10)9-5-3-2-4-6-9/h2-6,8,11H,7,10H2,1H3
 CKEKULWTUGAESO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNCC(c1ccccc1)C