N-(1-Phenylpropan-2-yl)-N-propylpropan-1-amine
 10700 C15H25N 219.366
 InChI=1S/C15H25N/c1-4-11-16(12-5-2)14(3)13-15-9-7-6-8-10-15/h6-10,14H,4-5,11-13H2,1-3H3
 COGKMFLJJLBANK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C(Cc1ccccc1)C)CCC