Mefenorex
3-Chloro-N-(1-phenylpropan-2-yl)propan-1-amine
 10696 C12H18ClN 211.731
 InChI=1S/C12H18ClN/c1-11(14-9-5-8-13)10-12-6-3-2-4-7-12/h2-4,6-7,11,14H,5,8-10H2,1H3
 XXVROGAVTTXONC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClCCCNC(Cc1ccccc1)C