Fenalcomine
1-(4-{2-[(1-Phenylpropan-2-yl)amino]ethoxy}phenyl)propan-1-ol
 10694 C20H27NO2 313.434
 InChI=1S/C20H27NO2/c1-3-20(22)18-9-11-19(12-10-18)23-14-13-21-16(2)15-17-7-5-4-6-8-17/h4-12,16,20-22H,3,13-15H2,1-2H3
 DOBLSWXRNYSVDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccc(cc1)OCCNC(Cc1ccccc1)C)O