Dextrofemine
1-Phenoxy-N-(1-phenylpropan-2-yl)propan-2-amine
 10693 C18H23NO 269.381
 InChI=1S/C18H23NO/c1-15(13-17-9-5-3-6-10-17)19-16(2)14-20-18-11-7-4-8-12-18/h3-12,15-16,19H,13-14H2,1-2H3
 URCIJDUOBBSMII-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC(Cc1ccccc1)C)COc1ccccc1