3-(Naphthalen-2-yl)-N-(2-phenylethyl)propan-1-amine
 10689  C21H23N  289.414
 InChI=1S/C21H23N/c1-2-7-18(8-3-1)14-16-22-15-6-9-19-12-13-20-10-4-5-11-21(20)17-19/h1-5,7-8,10-13,17,22H,6,9,14-16H2
 KGPBKPSEGUJNOI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C(CCc1ccc2c(c1)cccc2)NCCc1ccccc1