3-Phenyl-N-(2-phenylethyl)propan-1-amine
 10688 C17H21N 239.355
 InChI=1S/C17H21N/c1-3-8-16(9-4-1)12-7-14-18-15-13-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2
 MCXHGJLRTJKZGT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N(CCc1ccccc1)CCCc1ccccc1