3-(Naphthalen-2-yl)-N-(1-phenylpropan-2-yl)propan-1-amine
 10684 C22H25N 303.441
 InChI=1S/C22H25N/c1-18(16-19-8-3-2-4-9-19)23-15-7-10-20-13-14-21-11-5-6-12-22(21)17-20/h2-6,8-9,11-14,17-18,23H,7,10,15-16H2,1H3
 CURRDSALUJDOSU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCCc1ccc2c(c1)cccc2