3-(Naphthalen-1-yl)-N-(1-phenylpropan-2-yl)propan-1-amine
 10683 C22H25N 303.441
 InChI=1S/C22H25N/c1-18(17-19-9-3-2-4-10-19)23-16-8-14-21-13-7-12-20-11-5-6-15-22(20)21/h2-7,9-13,15,18,23H,8,14,16-17H2,1H3
 NTMSWDIZTFJRJK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCCc1cccc2c1cccc2